C31H34Cl2N8O5 — CID 174289141
2-[[6-[2-[5-(diaminomethylideneamino)pentanoyloxy]ethylamino]-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 174289141) has the molecular formula C31H34Cl2N8O5 and a molecular weight of 669.57 g/mol. Its IUPAC name is 2-[[6-[2-[5-(diaminomethylideneamino)pentanoyloxy]ethylamino]-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[6-[2-[5-(diaminomethylideneamino)pentanoyloxy]ethylamino]-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 174289141 |
| Molecular Formula | C31H34Cl2N8O5 |
| Molecular Weight | 669.57 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | 2-[[6-[2-[5-(diaminomethylideneamino)pentanoyloxy]ethylamino]-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-2-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1nc(NCCOC(=O)CCCCN=C(N)N)c(NCc2ccc(-c3cc(Cl)ccc3Cl)o2)c(Nc2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C31H34Cl2N8O5/c1-18-39-28(36-14-15-45-26(42)8-4-5-13-37-31(34)35)27(29(40-18)41-24-7-3-2-6-21(24)30(43)44)38-17-20-10-12-25(46-20)22-16-19(32)9-11-23(22)33/h2-3,6-7,9-12,16,38H,4-5,8,13-15,17H2,1H3,(H,43,44)(H4,34,35,37)(H2,36,39,40,41) |
| InChIKey | WEDZMSRSUPLPRA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 203.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|