C26H28Cl2N4O6 — CID 174289282
2-[[4-[2-(2-aminoethoxy)ethylamino]-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-4-oxobutanoyl]amino]benzoic acid (PubChem CID 174289282) has the molecular formula C26H28Cl2N4O6 and a molecular weight of 563.44 g/mol. Its IUPAC name is 2-[[4-[2-(2-aminoethoxy)ethylamino]-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 2-[[4-[2-(2-aminoethoxy)ethylamino]-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174289282 |
| Molecular Formula | C26H28Cl2N4O6 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 2-[[4-[2-(2-aminoethoxy)ethylamino]-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-4-oxobutanoyl]amino]benzoic acid |
| SMILES | NCCOCCNC(=O)CC(NCc1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H28Cl2N4O6/c27-16-5-7-20(28)19(13-16)23-8-6-17(38-23)15-31-22(14-24(33)30-10-12-37-11-9-29)25(34)32-21-4-2-1-3-18(21)26(35)36/h1-8,13,22,31H,9-12,14-15,29H2,(H,30,33)(H,32,34)(H,35,36) |
| InChIKey | YPKUJTVYMLCWJG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|