C43H54ClFO4 — CID 174289865
[(E)-6-propoxyhex-3-enyl] (E)-3-[4-chloro-2-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate (PubChem CID 174289865) has the molecular formula C43H54ClFO4 and a molecular weight of 689.35 g/mol. Its IUPAC name is [(E)-6-propoxyhex-3-enyl] (E)-3-[4-chloro-2-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate.
| Compound Name | [(E)-6-propoxyhex-3-enyl] (E)-3-[4-chloro-2-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 174289865 |
| Molecular Formula | C43H54ClFO4 |
| Molecular Weight | 689.35 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | [(E)-6-propoxyhex-3-enyl] (E)-3-[4-chloro-2-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]phenyl]-6-(6-fluoronaphthalen-1-yl)oxy-2-methylhex-2-enoate |
| SMILES | C=C(C)/C(=C(/C)C(C)CC)c1c(Cl)ccc(/C(CCCOc2cccc3cc(F)ccc23)=C(\C)C(=O)OCC/C=C/CCOCCC)c1C |
| InChI | InChI=1S/C43H54ClFO4/c1-9-24-47-25-13-11-12-14-26-49-43(46)33(8)36(18-16-27-48-40-19-15-17-34-28-35(45)20-21-38(34)40)37-22-23-39(44)42(32(37)7)41(29(3)4)31(6)30(5)10-2/h11-12,15,17,19-23,28,30H,3,9-10,13-14,16,18,24-27H2,1-2,4-8H3/b12-11+,36-33+,41-31+ |
| InChIKey | ICBMYQYGGMZVTC-LMYBQWNASA-N |
| XLogP | 12.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.35 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|