About N-ethyl-N,2-dihydroxytridecanamide
N-ethyl-N,2-dihydroxytridecanamide (PubChem CID 174289903) has the molecular formula C15H31NO3
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-ethyl-N,2-dihydroxytridecanamide.
Molecular Properties
| Compound Name | N-ethyl-N,2-dihydroxytridecanamide |
| PubChem CID | 174289903 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | N-ethyl-N,2-dihydroxytridecanamide |
| SMILES | CCCCCCCCCCCC(O)C(=O)N(O)CC |
| InChI | InChI=1S/C15H31NO3/c1-3-5-6-7-8-9-10-11-12-13-14(17)15(18)16(19)4-2/h14,17,19H,3-13H2,1-2H3 |
| InChIKey | RMRCQQLFRWEWKA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N,2-dihydroxytridecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,2-dihydroxytridecanamide?
The IUPAC name of N-ethyl-N,2-dihydroxytridecanamide (CID 174289903) is N-ethyl-N,2-dihydroxytridecanamide.
What is the SMILES notation for N-ethyl-N,2-dihydroxytridecanamide?
The canonical SMILES for N-ethyl-N,2-dihydroxytridecanamide is CCCCCCCCCCCC(O)C(=O)N(O)CC.
What is the InChIKey of N-ethyl-N,2-dihydroxytridecanamide?
The InChIKey is RMRCQQLFRWEWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO3/c1-3-5-6-7-8-9-10-11-12-13-14(17)15(18)16(19)4-2/h14,17,19H,3-13H2,1-2H3.
What are the key properties of N-ethyl-N,2-dihydroxytridecanamide?
N-ethyl-N,2-dihydroxytridecanamide has a molecular weight of 273.42 g/mol, XLogP of 3.51, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,2-dihydroxytridecanamide is sourced from PubChem (CID 174289903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).