C12H15FO — CID 174290480
(2R)-6-fluoro-1-methoxy-2-methyl-1,2,4a,8a-tetrahydronaphthalene (PubChem CID 174290480) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is (2R)-6-fluoro-1-methoxy-2-methyl-1,2,4a,8a-tetrahydronaphthalene.
| Compound Name | (2R)-6-fluoro-1-methoxy-2-methyl-1,2,4a,8a-tetrahydronaphthalene |
|---|---|
| PubChem CID | 174290480 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2R)-6-fluoro-1-methoxy-2-methyl-1,2,4a,8a-tetrahydronaphthalene |
| SMILES | COC1C2C=CC(F)=CC2C=C[C@H]1C |
| InChI | InChI=1S/C12H15FO/c1-8-3-4-9-7-10(13)5-6-11(9)12(8)14-2/h3-9,11-12H,1-2H3/t8-,9?,11?,12?/m1/s1 |
| InChIKey | ZJCOZKUYEZATOG-NVGMAVIKSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|