C22H17FN2O4S — CID 17429171
N-(1,3-benzodioxol-5-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 17429171) has the molecular formula C22H17FN2O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 17429171 |
| Molecular Formula | C22H17FN2O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | O=C(CSc1ccccc1C(=O)Nc1ccc2c(c1)OCO2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN2O4S/c23-14-5-7-15(8-6-14)24-21(26)12-30-20-4-2-1-3-17(20)22(27)25-16-9-10-18-19(11-16)29-13-28-18/h1-11H,12-13H2,(H,24,26)(H,25,27) |
| InChIKey | KXQQPLYOOGTQER-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |