About 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde
2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde (PubChem CID 174291782) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde |
| PubChem CID | 174291782 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde |
| SMILES | Cc1[nH]c(=O)nc(NCC=O)c1C |
| InChI | InChI=1S/C8H11N3O2/c1-5-6(2)10-8(13)11-7(5)9-3-4-12/h4H,3H2,1-2H3,(H2,9,10,11,13) |
| InChIKey | NSJVFZAQIPPBPE-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde?
The IUPAC name of 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde (CID 174291782) is 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde.
What is the SMILES notation for 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde?
The canonical SMILES for 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde is Cc1[nH]c(=O)nc(NCC=O)c1C.
What is the InChIKey of 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde?
The InChIKey is NSJVFZAQIPPBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-5-6(2)10-8(13)11-7(5)9-3-4-12/h4H,3H2,1-2H3,(H2,9,10,11,13).
What are the key properties of 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde?
2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde has a molecular weight of 181.19 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethyl-2-oxo-1H-pyrimidin-4-yl)amino]acetaldehyde is sourced from PubChem (CID 174291782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).