About 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid
2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid (PubChem CID 174291863) has the molecular formula C25H22Cl2N2O5
and a molecular weight of 501.37 g/mol. Its IUPAC name is 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid |
| PubChem CID | 174291863 |
| Molecular Formula | C25H22Cl2N2O5 |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)C1CCCCC(=O)N1Cc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C25H22Cl2N2O5/c26-15-9-11-19(27)18(13-15)22-12-10-16(34-22)14-29-21(7-3-4-8-23(29)30)24(31)28-20-6-2-1-5-17(20)25(32)33/h1-2,5-6,9-13,21H,3-4,7-8,14H2,(H,28,31)(H,32,33) |
| InChIKey | AEQOLQSTNUUVCJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid?
The IUPAC name of 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid (CID 174291863) is 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid.
What is the SMILES notation for 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid?
The canonical SMILES for 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid is O=C(O)c1ccccc1NC(=O)C1CCCCC(=O)N1Cc1ccc(-c2cc(Cl)ccc2Cl)o1.
What is the InChIKey of 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid?
The InChIKey is AEQOLQSTNUUVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22Cl2N2O5/c26-15-9-11-19(27)18(13-15)22-12-10-16(34-22)14-29-21(7-3-4-8-23(29)30)24(31)28-20-6-2-1-5-17(20)25(32)33/h1-2,5-6,9-13,21H,3-4,7-8,14H2,(H,28,31)(H,32,33).
What are the key properties of 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid?
2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid has a molecular weight of 501.37 g/mol, XLogP of 5.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-7-oxoazepane-2-carbonyl]amino]benzoic acid is sourced from PubChem (CID 174291863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).