C16H24N2 — CID 174292093
4b-methyl-8-propan-2-yl-2,5,6,8a-tetrahydro-1H-carbazol-9-amine (PubChem CID 174292093) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 4b-methyl-8-propan-2-yl-2,5,6,8a-tetrahydro-1H-carbazol-9-amine.
| Compound Name | 4b-methyl-8-propan-2-yl-2,5,6,8a-tetrahydro-1H-carbazol-9-amine |
|---|---|
| PubChem CID | 174292093 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 4b-methyl-8-propan-2-yl-2,5,6,8a-tetrahydro-1H-carbazol-9-amine |
| SMILES | CC(C)C1=CCCC2(C)C3=C(CCC=C3)N(N)C12 |
| InChI | InChI=1S/C16H24N2/c1-11(2)12-7-6-10-16(3)13-8-4-5-9-14(13)18(17)15(12)16/h4,7-8,11,15H,5-6,9-10,17H2,1-3H3 |
| InChIKey | DFHCVWKKEAAKLZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|