C15H24FN — CID 174292959
(5Z)-5-fluoro-2,7-dimethyl-N-[(Z)-pent-2-en-2-yl]octa-1,5-dien-4-imine (PubChem CID 174292959) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is (5Z)-5-fluoro-2,7-dimethyl-N-[(Z)-pent-2-en-2-yl]octa-1,5-dien-4-imine.
| Compound Name | (5Z)-5-fluoro-2,7-dimethyl-N-[(Z)-pent-2-en-2-yl]octa-1,5-dien-4-imine |
|---|---|
| PubChem CID | 174292959 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (5Z)-5-fluoro-2,7-dimethyl-N-[(Z)-pent-2-en-2-yl]octa-1,5-dien-4-imine |
| SMILES | C=C(C)CC(=N/C(C)=C\CC)/C(F)=C/C(C)C |
| InChI | InChI=1S/C15H24FN/c1-7-8-13(6)17-15(10-12(4)5)14(16)9-11(2)3/h8-9,11H,4,7,10H2,1-3,5-6H3/b13-8-,14-9-,17-15- |
| InChIKey | GVSQYVMRSZOOFJ-OBHBJZIXSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|