C14H24Cl2N6O4S — CID 174293236
2-[(4,6-dichloro-1,3,5-triazinan-2-yl)amino]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propylsulfanyl]propanoic acid (PubChem CID 174293236) has the molecular formula C14H24Cl2N6O4S and a molecular weight of 443.36 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazinan-2-yl)amino]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propylsulfanyl]propanoic acid.
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazinan-2-yl)amino]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 174293236 |
| Molecular Formula | C14H24Cl2N6O4S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazinan-2-yl)amino]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propylsulfanyl]propanoic acid |
| SMILES | CC1(C)NC(=O)N(CCCSCC(NC2NC(Cl)NC(Cl)N2)C(=O)O)C1=O |
| InChI | InChI=1S/C14H24Cl2N6O4S/c1-14(2)9(25)22(13(26)21-14)4-3-5-27-6-7(8(23)24)17-12-19-10(15)18-11(16)20-12/h7,10-12,17-20H,3-6H2,1-2H3,(H,21,26)(H,23,24) |
| InChIKey | CJPSIJPZBGSQAF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 134.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|