C66H57BN2S2 — CID 174293631
4,11,18-tritert-butyl-8,14-bis(3-dibenzothiophen-1-ylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 174293631) has the molecular formula C66H57BN2S2 and a molecular weight of 953.14 g/mol. Its IUPAC name is 4,11,18-tritert-butyl-8,14-bis(3-dibenzothiophen-1-ylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,11,18-tritert-butyl-8,14-bis(3-dibenzothiophen-1-ylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 174293631 |
| Molecular Formula | C66H57BN2S2 |
| Molecular Weight | 953.14 g/mol |
| Exact Mass | 952.41 |
| IUPAC Name | 4,11,18-tritert-butyl-8,14-bis(3-dibenzothiophen-1-ylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3cc(C(C)(C)C)ccc3N(c3cccc(-c4cccc5sc6ccccc6c45)c3)c3cc(C(C)(C)C)cc(c31)N2c1cccc(-c2cccc3sc4ccccc4c23)c1 |
| InChI | InChI=1S/C66H57BN2S2/c1-64(2,3)42-30-32-53-51(36-42)67-52-37-43(65(4,5)6)31-33-54(52)69(46-21-15-19-41(35-46)48-25-17-29-60-62(48)50-23-11-13-27-58(50)71-60)56-39-44(66(7,8)9)38-55(63(56)67)68(53)45-20-14-18-40(34-45)47-24-16-28-59-61(47)49-22-10-12-26-57(49)70-59/h10-39H,1-9H3 |
| InChIKey | LXNZOGQIXFWLJE-UHFFFAOYSA-N |
| XLogP | 17.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.14 |
| LogP ≤ 5 | 17.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|