About 5-butoxy-6-sulfinylcyclohexa-1,3-diene
5-butoxy-6-sulfinylcyclohexa-1,3-diene (PubChem CID 174293849) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 5-butoxy-6-sulfinylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-butoxy-6-sulfinylcyclohexa-1,3-diene |
| PubChem CID | 174293849 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 5-butoxy-6-sulfinylcyclohexa-1,3-diene |
| SMILES | CCCCOC1C=CC=CC1=S=O |
| InChI | InChI=1S/C10H14O2S/c1-2-3-8-12-9-6-4-5-7-10(9)13-11/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | FIDMDFJBZSEHRA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-6-sulfinylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-6-sulfinylcyclohexa-1,3-diene?
The IUPAC name of 5-butoxy-6-sulfinylcyclohexa-1,3-diene (CID 174293849) is 5-butoxy-6-sulfinylcyclohexa-1,3-diene.
What is the SMILES notation for 5-butoxy-6-sulfinylcyclohexa-1,3-diene?
The canonical SMILES for 5-butoxy-6-sulfinylcyclohexa-1,3-diene is CCCCOC1C=CC=CC1=S=O.
What is the InChIKey of 5-butoxy-6-sulfinylcyclohexa-1,3-diene?
The InChIKey is FIDMDFJBZSEHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S/c1-2-3-8-12-9-6-4-5-7-10(9)13-11/h4-7,9H,2-3,8H2,1H3.
What are the key properties of 5-butoxy-6-sulfinylcyclohexa-1,3-diene?
5-butoxy-6-sulfinylcyclohexa-1,3-diene has a molecular weight of 198.29 g/mol, XLogP of 1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-6-sulfinylcyclohexa-1,3-diene is sourced from PubChem (CID 174293849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).