C35H31NO5S — CID 174294145
[1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydrochrysen-5-yl]methyl methanesulfonate (PubChem CID 174294145) has the molecular formula C35H31NO5S and a molecular weight of 577.70 g/mol. Its IUPAC name is [1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydrochrysen-5-yl]methyl methanesulfonate.
| Compound Name | [1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydrochrysen-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 174294145 |
| Molecular Formula | C35H31NO5S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | [1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydrochrysen-5-yl]methyl methanesulfonate |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)C2=c3ccc4c(c3CCC2)C(COS(C)(=O)=O)C=c2ccccc2=4)cc1 |
| InChI | InChI=1S/C35H31NO5S/c1-22-8-3-5-10-27(22)35(38)36-26-16-14-23(15-17-26)34(37)32-13-7-12-30-29(32)18-19-31-28-11-6-4-9-24(28)20-25(33(30)31)21-41-42(2,39)40/h3-6,8-11,14-20,25H,7,12-13,21H2,1-2H3,(H,36,38) |
| InChIKey | MQGZTWATQAHAKQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|