About 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride
2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride (PubChem CID 174294166) has the molecular formula C10H19FO2
and a molecular weight of 190.26 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride.
Molecular Properties
| Compound Name | 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride |
| PubChem CID | 174294166 |
| Molecular Formula | C10H19FO2 |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride |
| SMILES | CC(C)(C)CCOC(C)(C)C(=O)F |
| InChI | InChI=1S/C10H19FO2/c1-9(2,3)6-7-13-10(4,5)8(11)12/h6-7H2,1-5H3 |
| InChIKey | IWSAKYWQJIPWCG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride?
The IUPAC name of 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride (CID 174294166) is 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride.
What is the SMILES notation for 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride?
The canonical SMILES for 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride is CC(C)(C)CCOC(C)(C)C(=O)F.
What is the InChIKey of 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride?
The InChIKey is IWSAKYWQJIPWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FO2/c1-9(2,3)6-7-13-10(4,5)8(11)12/h6-7H2,1-5H3.
What are the key properties of 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride?
2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride has a molecular weight of 190.26 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbutoxy)-2-methylpropanoyl fluoride is sourced from PubChem (CID 174294166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).