C16H22N2O6 — CID 174294245
1-(2-methoxyethoxy)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;5-methyl-1H-pyrazole (PubChem CID 174294245) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;5-methyl-1H-pyrazole.
| Compound Name | 1-(2-methoxyethoxy)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 174294245 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-(2-methoxyethoxy)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;5-methyl-1H-pyrazole |
| SMILES | COCCOC1(C(=O)O)C=CC=C(C(=O)O)C1C.Cc1ccn[nH]1 |
| InChI | InChI=1S/C12H16O6.C4H6N2/c1-8-9(10(13)14)4-3-5-12(8,11(15)16)18-7-6-17-2;1-4-2-3-5-6-4/h3-5,8H,6-7H2,1-2H3,(H,13,14)(H,15,16);2-3H,1H3,(H,5,6) |
| InChIKey | KEUOLKPGWNWKQZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|