C27H21N3O5S — CID 174294275
1-nitro-1-(8,9,10,11-tetrahydrochrysen-1-yl)-2,4-benzodiazepine-3-sulfonic acid (PubChem CID 174294275) has the molecular formula C27H21N3O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is 1-nitro-1-(8,9,10,11-tetrahydrochrysen-1-yl)-2,4-benzodiazepine-3-sulfonic acid.
| Compound Name | 1-nitro-1-(8,9,10,11-tetrahydrochrysen-1-yl)-2,4-benzodiazepine-3-sulfonic acid |
|---|---|
| PubChem CID | 174294275 |
| Molecular Formula | C27H21N3O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1-nitro-1-(8,9,10,11-tetrahydrochrysen-1-yl)-2,4-benzodiazepine-3-sulfonic acid |
| SMILES | O=[N+]([O-])C1(c2cccc3c2=CCc2c4c(ccc2=3)=CCCC4)N=C(S(=O)(=O)O)N=Cc2ccccc21 |
| InChI | InChI=1S/C27H21N3O5S/c31-30(32)27(24-10-4-2-7-18(24)16-28-26(29-27)36(33,34)35)25-11-5-9-20-22-13-12-17-6-1-3-8-19(17)21(22)14-15-23(20)25/h2,4-7,9-13,15-16H,1,3,8,14H2,(H,33,34,35) |
| InChIKey | XFGXMZJBHUFNPA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|