C16H19N3O3S — CID 174294345
2-[3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidin-4-yl]-2-oxoacetaldehyde (PubChem CID 174294345) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidin-4-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidin-4-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174294345 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidin-4-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1COCN1CCCCSc1cccc2nccn12 |
| InChI | InChI=1S/C16H19N3O3S/c20-10-14(21)13-11-22-12-18(13)7-1-2-9-23-16-5-3-4-15-17-6-8-19(15)16/h3-6,8,10,13H,1-2,7,9,11-12H2 |
| InChIKey | JSRJDKQNDCSUSY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|