C11H18N6O2 — CID 174294446
2,8-diamino-9-(oxan-2-ylmethyl)-7,8-dihydro-1H-purin-6-one (PubChem CID 174294446) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2,8-diamino-9-(oxan-2-ylmethyl)-7,8-dihydro-1H-purin-6-one.
| Compound Name | 2,8-diamino-9-(oxan-2-ylmethyl)-7,8-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 174294446 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2,8-diamino-9-(oxan-2-ylmethyl)-7,8-dihydro-1H-purin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)NC(N)N2CC1CCCCO1 |
| InChI | InChI=1S/C11H18N6O2/c12-10-15-8-7(9(18)16-10)14-11(13)17(8)5-6-3-1-2-4-19-6/h6,11,14H,1-5,13H2,(H3,12,15,16,18) |
| InChIKey | KJEQRZQYKRCPEX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |