About 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid
4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid (PubChem CID 174294577) has the molecular formula C6H6N2O2S
and a molecular weight of 170.19 g/mol. Its IUPAC name is 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid |
| PubChem CID | 174294577 |
| Molecular Formula | C6H6N2O2S |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid |
| SMILES | O=C(O)C1SCc2[nH]cnc21 |
| InChI | InChI=1S/C6H6N2O2S/c9-6(10)5-4-3(1-11-5)7-2-8-4/h2,5H,1H2,(H,7,8)(H,9,10) |
| InChIKey | LMMIRXQNKURNKX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid?
The IUPAC name of 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid (CID 174294577) is 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid.
What is the SMILES notation for 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid?
The canonical SMILES for 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid is O=C(O)C1SCc2[nH]cnc21.
What is the InChIKey of 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid?
The InChIKey is LMMIRXQNKURNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2S/c9-6(10)5-4-3(1-11-5)7-2-8-4/h2,5H,1H2,(H,7,8)(H,9,10).
What are the key properties of 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid?
4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid has a molecular weight of 170.19 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dihydro-1H-thieno[3,4-d]imidazole-4-carboxylic acid is sourced from PubChem (CID 174294577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).