C18H16FN3 — CID 174294674
4-[3-cyclopropyl-5-(4-fluorophenyl)-2-methylimidazol-4-yl]pyridine (PubChem CID 174294674) has the molecular formula C18H16FN3 and a molecular weight of 293.35 g/mol. Its IUPAC name is 4-[3-cyclopropyl-5-(4-fluorophenyl)-2-methylimidazol-4-yl]pyridine.
| Compound Name | 4-[3-cyclopropyl-5-(4-fluorophenyl)-2-methylimidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 174294674 |
| Molecular Formula | C18H16FN3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[3-cyclopropyl-5-(4-fluorophenyl)-2-methylimidazol-4-yl]pyridine |
| SMILES | Cc1nc(-c2ccc(F)cc2)c(-c2ccncc2)n1C1CC1 |
| InChI | InChI=1S/C18H16FN3/c1-12-21-17(13-2-4-15(19)5-3-13)18(22(12)16-6-7-16)14-8-10-20-11-9-14/h2-5,8-11,16H,6-7H2,1H3 |
| InChIKey | QURJEFINAJLFRF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |