C18H17NO — CID 174294829
3-amino-1,2,5,6-tetrahydrochrysen-1-ol (PubChem CID 174294829) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-amino-1,2,5,6-tetrahydrochrysen-1-ol.
| Compound Name | 3-amino-1,2,5,6-tetrahydrochrysen-1-ol |
|---|---|
| PubChem CID | 174294829 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-amino-1,2,5,6-tetrahydrochrysen-1-ol |
| SMILES | NC1=Cc2c(ccc3c2CCc2ccccc2-3)C(O)C1 |
| InChI | InChI=1S/C18H17NO/c19-12-9-17-15-6-5-11-3-1-2-4-13(11)14(15)7-8-16(17)18(20)10-12/h1-4,7-9,18,20H,5-6,10,19H2 |
| InChIKey | PCPCZNXZHQPCKH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |