About (3-bromo-5-nitrophenyl) 2-aminobutanoate
(3-bromo-5-nitrophenyl) 2-aminobutanoate (PubChem CID 174295224) has the molecular formula C10H11BrN2O4
and a molecular weight of 303.11 g/mol. Its IUPAC name is (3-bromo-5-nitrophenyl) 2-aminobutanoate.
Molecular Properties
| Compound Name | (3-bromo-5-nitrophenyl) 2-aminobutanoate |
| PubChem CID | 174295224 |
| Molecular Formula | C10H11BrN2O4 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | (3-bromo-5-nitrophenyl) 2-aminobutanoate |
| SMILES | CCC(N)C(=O)Oc1cc(Br)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11BrN2O4/c1-2-9(12)10(14)17-8-4-6(11)3-7(5-8)13(15)16/h3-5,9H,2,12H2,1H3 |
| InChIKey | QEDZRQNQRNQJJD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-5-nitrophenyl) 2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-5-nitrophenyl) 2-aminobutanoate?
The IUPAC name of (3-bromo-5-nitrophenyl) 2-aminobutanoate (CID 174295224) is (3-bromo-5-nitrophenyl) 2-aminobutanoate.
What is the SMILES notation for (3-bromo-5-nitrophenyl) 2-aminobutanoate?
The canonical SMILES for (3-bromo-5-nitrophenyl) 2-aminobutanoate is CCC(N)C(=O)Oc1cc(Br)cc([N+](=O)[O-])c1.
What is the InChIKey of (3-bromo-5-nitrophenyl) 2-aminobutanoate?
The InChIKey is QEDZRQNQRNQJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O4/c1-2-9(12)10(14)17-8-4-6(11)3-7(5-8)13(15)16/h3-5,9H,2,12H2,1H3.
What are the key properties of (3-bromo-5-nitrophenyl) 2-aminobutanoate?
(3-bromo-5-nitrophenyl) 2-aminobutanoate has a molecular weight of 303.11 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-5-nitrophenyl) 2-aminobutanoate is sourced from PubChem (CID 174295224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).