About 2-fluoro-2H-chromen-3-ol
2-fluoro-2H-chromen-3-ol (PubChem CID 174296888) has the molecular formula C9H7FO2
and a molecular weight of 166.15 g/mol. Its IUPAC name is 2-fluoro-2H-chromen-3-ol.
Molecular Properties
| Compound Name | 2-fluoro-2H-chromen-3-ol |
| PubChem CID | 174296888 |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 2-fluoro-2H-chromen-3-ol |
| SMILES | OC1=Cc2ccccc2OC1F |
| InChI | InChI=1S/C9H7FO2/c10-9-7(11)5-6-3-1-2-4-8(6)12-9/h1-5,9,11H |
| InChIKey | YMOKXEQVKFRWIF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-2H-chromen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2H-chromen-3-ol?
The IUPAC name of 2-fluoro-2H-chromen-3-ol (CID 174296888) is 2-fluoro-2H-chromen-3-ol.
What is the SMILES notation for 2-fluoro-2H-chromen-3-ol?
The canonical SMILES for 2-fluoro-2H-chromen-3-ol is OC1=Cc2ccccc2OC1F.
What is the InChIKey of 2-fluoro-2H-chromen-3-ol?
The InChIKey is YMOKXEQVKFRWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO2/c10-9-7(11)5-6-3-1-2-4-8(6)12-9/h1-5,9,11H.
What are the key properties of 2-fluoro-2H-chromen-3-ol?
2-fluoro-2H-chromen-3-ol has a molecular weight of 166.15 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2H-chromen-3-ol is sourced from PubChem (CID 174296888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).