C9H13NO — CID 174296969
(3E,5Z)-5-(aminomethyl)octa-1,3,5,7-tetraen-4-ol (PubChem CID 174296969) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (3E,5Z)-5-(aminomethyl)octa-1,3,5,7-tetraen-4-ol.
| Compound Name | (3E,5Z)-5-(aminomethyl)octa-1,3,5,7-tetraen-4-ol |
|---|---|
| PubChem CID | 174296969 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3E,5Z)-5-(aminomethyl)octa-1,3,5,7-tetraen-4-ol |
| SMILES | C=C/C=C(CN)\C(O)=C/C=C |
| InChI | InChI=1S/C9H13NO/c1-3-5-8(7-10)9(11)6-4-2/h3-6,11H,1-2,7,10H2/b8-5-,9-6+ |
| InChIKey | ABCWWZBIBXOENF-LDFAFZTOSA-N |
| XLogP | 1.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|