About propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane
propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane (PubChem CID 174297131) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane.
Molecular Properties
| Compound Name | propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane |
| PubChem CID | 174297131 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane |
| SMILES | CC(C)C1(OC2(C(C)C)CCCCC2)CCCCC1.CC(O)CO |
| InChI | InChI=1S/C18H34O.C3H8O2/c1-15(2)17(11-7-5-8-12-17)19-18(16(3)4)13-9-6-10-14-18;1-3(5)2-4/h15-16H,5-14H2,1-4H3;3-5H,2H2,1H3 |
| InChIKey | NHOTXDVBKBAMOY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane?
The IUPAC name of propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane (CID 174297131) is propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane.
What is the SMILES notation for propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane?
The canonical SMILES for propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane is CC(C)C1(OC2(C(C)C)CCCCC2)CCCCC1.CC(O)CO.
What is the InChIKey of propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane?
The InChIKey is NHOTXDVBKBAMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O.C3H8O2/c1-15(2)17(11-7-5-8-12-17)19-18(16(3)4)13-9-6-10-14-18;1-3(5)2-4/h15-16H,5-14H2,1-4H3;3-5H,2H2,1H3.
What are the key properties of propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane?
propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane has a molecular weight of 342.56 g/mol, XLogP of 5.08, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diol;1-propan-2-yl-1-(1-propan-2-ylcyclohexyl)oxycyclohexane is sourced from PubChem (CID 174297131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).