C24H30N+ — CID 174297641
6-ethenyl-2-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,6-dimethyl-1,3-dihydrocyclohepta[c]pyrrol-2-ium (PubChem CID 174297641) has the molecular formula C24H30N+ and a molecular weight of 332.51 g/mol. Its IUPAC name is 6-ethenyl-2-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,6-dimethyl-1,3-dihydrocyclohepta[c]pyrrol-2-ium.
| Compound Name | 6-ethenyl-2-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,6-dimethyl-1,3-dihydrocyclohepta[c]pyrrol-2-ium |
|---|---|
| PubChem CID | 174297641 |
| Molecular Formula | C24H30N+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 6-ethenyl-2-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,6-dimethyl-1,3-dihydrocyclohepta[c]pyrrol-2-ium |
| SMILES | C=CC1(C)C=CC=C(C[N+]2(C)CC3=C(C=CC(C)(C=C)C=C3)C2)C=C1 |
| InChI | InChI=1S/C24H30N/c1-6-23(3)13-8-9-20(10-14-23)17-25(5)18-21-11-15-24(4,7-2)16-12-22(21)19-25/h6-16H,1-2,17-19H2,3-5H3/q+1 |
| InChIKey | RQHXEQBNJZLDKA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|