C25H47NS — CID 174297879
N,N-diethyl-1-[(4S)-3-ethyl-5-methyl-4-[[(1S,3S,4S)-2,3,4-trimethylcyclohexyl]methyl]cyclohexyl]sulfanylethenamine (PubChem CID 174297879) has the molecular formula C25H47NS and a molecular weight of 393.73 g/mol. Its IUPAC name is N,N-diethyl-1-[(4S)-3-ethyl-5-methyl-4-[[(1S,3S,4S)-2,3,4-trimethylcyclohexyl]methyl]cyclohexyl]sulfanylethenamine.
| Compound Name | N,N-diethyl-1-[(4S)-3-ethyl-5-methyl-4-[[(1S,3S,4S)-2,3,4-trimethylcyclohexyl]methyl]cyclohexyl]sulfanylethenamine |
|---|---|
| PubChem CID | 174297879 |
| Molecular Formula | C25H47NS |
| Molecular Weight | 393.73 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | N,N-diethyl-1-[(4S)-3-ethyl-5-methyl-4-[[(1S,3S,4S)-2,3,4-trimethylcyclohexyl]methyl]cyclohexyl]sulfanylethenamine |
| SMILES | C=C(SC1CC(C)[C@H](C[C@@H]2CC[C@H](C)[C@H](C)C2C)C(CC)C1)N(CC)CC |
| InChI | InChI=1S/C25H47NS/c1-9-22-15-24(27-21(8)26(10-2)11-3)14-18(5)25(22)16-23-13-12-17(4)19(6)20(23)7/h17-20,22-25H,8-16H2,1-7H3/t17-,18?,19-,20?,22?,23-,24?,25-/m0/s1 |
| InChIKey | YBUHLSLPNXKLSL-LDWYUUQSSA-N |
| XLogP | 7.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.73 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |