C23H26N10O2S — CID 174298209
[(2S)-1-[7-amino-2-(1,3-thiazol-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[hydroxy(phenyl)methyl]piperazin-1-yl]methanone (PubChem CID 174298209) has the molecular formula C23H26N10O2S and a molecular weight of 506.60 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(1,3-thiazol-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[hydroxy(phenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[7-amino-2-(1,3-thiazol-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[hydroxy(phenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 174298209 |
| Molecular Formula | C23H26N10O2S |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [(2S)-1-[7-amino-2-(1,3-thiazol-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-[4-[hydroxy(phenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Nc1nc(N2CCC[C@H]2C(=O)N2CCN(C(O)c3ccccc3)CC2)nc2nc(-c3nccs3)nn12 |
| InChI | InChI=1S/C23H26N10O2S/c24-21-27-22(28-23-26-17(29-33(21)23)18-25-8-14-36-18)32-9-4-7-16(32)20(35)31-12-10-30(11-13-31)19(34)15-5-2-1-3-6-15/h1-3,5-6,8,14,16,19,34H,4,7,9-13H2,(H2,24,26,27,28,29)/t16-,19?/m0/s1 |
| InChIKey | VNPAXHNJKBDNJM-UCFFOFKASA-N |
| XLogP | 1.03 |
| TPSA | 141.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |