About CID 174298438
CID 174298438 (PubChem CID 174298438) has the molecular formula C7H11B2N
and a molecular weight of 130.80 g/mol.
Molecular Properties
| Compound Name | CID 174298438 |
| PubChem CID | 174298438 |
| Molecular Formula | C7H11B2N |
| Molecular Weight | 130.80 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | — |
| SMILES | [B]C1CCC2(C1)CN([B])C2 |
| InChI | InChI=1S/C7H11B2N/c8-6-1-2-7(3-6)4-10(9)5-7/h6H,1-5H2 |
| InChIKey | BJRLQDUUHGDQOQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.80 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174298438 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174298438?
The IUPAC name of CID 174298438 (CID 174298438) is not available.
What is the SMILES notation for CID 174298438?
The canonical SMILES for CID 174298438 is [B]C1CCC2(C1)CN([B])C2.
What is the InChIKey of CID 174298438?
The InChIKey is BJRLQDUUHGDQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11B2N/c8-6-1-2-7(3-6)4-10(9)5-7/h6H,1-5H2.
What are the key properties of CID 174298438?
CID 174298438 has a molecular weight of 130.80 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174298438 is sourced from PubChem (CID 174298438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).