imidazolidine;oxalic acid

C5H10N2O4 — CID 174299002

IUPACimidazolidine;oxalic acid
SMILESC1CNCN1.O=C(O)C(=O)O
InChIInChI=1S/C3H8N2.C2H2O4/c1-2-5-3-4-1;3-1(4)2(5)6/h4-5H,1-3H2;(H,3,4)(H,5,6)
InChIKeyHTYPZEGTHLOUSU-UHFFFAOYSA-N
MW162.14 g/mol
LogP-1.71
Rot. Bonds

About imidazolidine;oxalic acid

imidazolidine;oxalic acid (PubChem CID 174299002) has the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. Its IUPAC name is imidazolidine;oxalic acid.

Molecular Properties

Compound Nameimidazolidine;oxalic acid
PubChem CID174299002
Molecular FormulaC5H10N2O4
Molecular Weight162.14 g/mol
Exact Mass162.06
IUPAC Nameimidazolidine;oxalic acid
SMILESC1CNCN1.O=C(O)C(=O)O
InChIInChI=1S/C3H8N2.C2H2O4/c1-2-5-3-4-1;3-1(4)2(5)6/h4-5H,1-3H2;(H,3,4)(H,5,6)
InChIKeyHTYPZEGTHLOUSU-UHFFFAOYSA-N
XLogP-1.71
TPSA98.66 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.14
LogP ≤ 5-1.71
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze imidazolidine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of imidazolidine;oxalic acid?
The IUPAC name of imidazolidine;oxalic acid (CID 174299002) is imidazolidine;oxalic acid.
What is the SMILES notation for imidazolidine;oxalic acid?
The canonical SMILES for imidazolidine;oxalic acid is C1CNCN1.O=C(O)C(=O)O.
What is the InChIKey of imidazolidine;oxalic acid?
The InChIKey is HTYPZEGTHLOUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2.C2H2O4/c1-2-5-3-4-1;3-1(4)2(5)6/h4-5H,1-3H2;(H,3,4)(H,5,6).
What are the key properties of imidazolidine;oxalic acid?
imidazolidine;oxalic acid has a molecular weight of 162.14 g/mol, XLogP of -1.71, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine;oxalic acid is sourced from PubChem (CID 174299002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).