C8H8F3NO2 — CID 174299524
(2E,4E)-6,6,6-trifluoro-5-methanimidoyl-2-methylhexa-2,4-dienoic acid (PubChem CID 174299524) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is (2E,4E)-6,6,6-trifluoro-5-methanimidoyl-2-methylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6,6,6-trifluoro-5-methanimidoyl-2-methylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 174299524 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (2E,4E)-6,6,6-trifluoro-5-methanimidoyl-2-methylhexa-2,4-dienoic acid |
| SMILES | [H]/N=C/C(=C\C=C(/C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2/c1-5(7(13)14)2-3-6(4-12)8(9,10)11/h2-4,12H,1H3,(H,13,14)/b5-2+,6-3+,12-4+ |
| InChIKey | OFRJYADXFVFXIF-CKSIIMNLSA-N |
| XLogP | 2.16 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|