C10H17N — CID 174299549
3,7-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 174299549) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3,7-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 3,7-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 174299549 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3,7-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | CC1=CNC2C(C)CCCC12 |
| InChI | InChI=1S/C10H17N/c1-7-4-3-5-9-8(2)6-11-10(7)9/h6-7,9-11H,3-5H2,1-2H3 |
| InChIKey | AJENGVPPSYHYNQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |