C54H38N6O — CID 174300084
2-dibenzofuran-4-yl-4-phenyl-6-[3-(4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine (PubChem CID 174300084) has the molecular formula C54H38N6O and a molecular weight of 786.94 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-4-phenyl-6-[3-(4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-4-yl-4-phenyl-6-[3-(4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174300084 |
| Molecular Formula | C54H38N6O |
| Molecular Weight | 786.94 g/mol |
| Exact Mass | 786.31 |
| IUPAC Name | 2-dibenzofuran-4-yl-4-phenyl-6-[3-(4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc6c5oc5ccccc56)n4)c3)nc(-c3cccc4c3-c3ccccc3C43CCCCC3)n2)cc1 |
| InChI | InChI=1S/C54H38N6O/c1-4-17-34(18-5-1)48-55-50(59-52(57-48)41-26-16-29-44-46(41)40-24-8-10-28-43(40)54(44)31-12-3-13-32-54)36-21-14-22-37(33-36)51-56-49(35-19-6-2-7-20-35)58-53(60-51)42-27-15-25-39-38-23-9-11-30-45(38)61-47(39)42/h1-2,4-11,14-30,33H,3,12-13,31-32H2 |
| InChIKey | XRXAFEFGRSUGCU-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.94 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |