About acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione
acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 174301366) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 174301366 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(=O)O.CCC1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C8H8O2.C2H4O2/c1-2-6-5-7(9)3-4-8(6)10;1-2(3)4/h3-5H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | JYMZSRYOFJFWIW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione?
The IUPAC name of acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione (CID 174301366) is acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione is CC(=O)O.CCC1=CC(=O)C=CC1=O.
What is the InChIKey of acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione?
The InChIKey is JYMZSRYOFJFWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C2H4O2/c1-2-6-5-7(9)3-4-8(6)10;1-2(3)4/h3-5H,2H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione?
acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione has a molecular weight of 196.20 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-ethylcyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 174301366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).