C25H24N2O5 — CID 17430137
2-[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl]oxy-N-benzylbenzamide (PubChem CID 17430137) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl]oxy-N-benzylbenzamide.
| Compound Name | 2-[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl]oxy-N-benzylbenzamide |
|---|---|
| PubChem CID | 17430137 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl]oxy-N-benzylbenzamide |
| SMILES | CC(Oc1ccccc1C(=O)NCc1ccccc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H24N2O5/c1-17(24(28)26-15-19-11-12-22-23(13-19)31-16-30-22)32-21-10-6-5-9-20(21)25(29)27-14-18-7-3-2-4-8-18/h2-13,17H,14-16H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | BEJKYWJFOLUNJG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |