C12H7F5O4 — CID 174301429
3-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]carbonylbut-3-enoic acid (PubChem CID 174301429) has the molecular formula C12H7F5O4 and a molecular weight of 310.17 g/mol. Its IUPAC name is 3-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]carbonylbut-3-enoic acid.
| Compound Name | 3-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]carbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 174301429 |
| Molecular Formula | C12H7F5O4 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-[fluoro-(2,3,4,5-tetrafluorophenyl)methoxy]carbonylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OC(F)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H7F5O4/c1-4(2-7(18)19)12(20)21-11(17)5-3-6(13)9(15)10(16)8(5)14/h3,11H,1-2H2,(H,18,19) |
| InChIKey | DZESPRAVFKMXBS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|