About N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline
N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline (PubChem CID 174301538) has the molecular formula C22H27F2NO
and a molecular weight of 359.46 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline |
| PubChem CID | 174301538 |
| Molecular Formula | C22H27F2NO |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline |
| SMILES | Cc1ccc(COc2c(C)cc(NCC3CCCCC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H27F2NO/c1-15-8-10-18(11-9-15)14-26-22-16(2)12-19(20(23)21(22)24)25-13-17-6-4-3-5-7-17/h8-12,17,25H,3-7,13-14H2,1-2H3 |
| InChIKey | SQLRPSLXMSXMEA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline?
The IUPAC name of N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline (CID 174301538) is N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline.
What is the SMILES notation for N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline?
The canonical SMILES for N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline is Cc1ccc(COc2c(C)cc(NCC3CCCCC3)c(F)c2F)cc1.
What is the InChIKey of N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline?
The InChIKey is SQLRPSLXMSXMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2NO/c1-15-8-10-18(11-9-15)14-26-22-16(2)12-19(20(23)21(22)24)25-13-17-6-4-3-5-7-17/h8-12,17,25H,3-7,13-14H2,1-2H3.
What are the key properties of N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline?
N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline has a molecular weight of 359.46 g/mol, XLogP of 6.15, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-2,3-difluoro-5-methyl-4-[(4-methylphenyl)methoxy]aniline is sourced from PubChem (CID 174301538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).