C51H52N4O6 — CID 174301693
tert-butyl N-[[4-[(8,9,10,11-tetrahydrochrysene-2-carbonylamino)methyl]phenyl]methyl]carbamate;2-[4-(2-ethenylphenyl)-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid (PubChem CID 174301693) has the molecular formula C51H52N4O6 and a molecular weight of 817.00 g/mol. Its IUPAC name is tert-butyl N-[[4-[(8,9,10,11-tetrahydrochrysene-2-carbonylamino)methyl]phenyl]methyl]carbamate;2-[4-(2-ethenylphenyl)-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid.
| Compound Name | tert-butyl N-[[4-[(8,9,10,11-tetrahydrochrysene-2-carbonylamino)methyl]phenyl]methyl]carbamate;2-[4-(2-ethenylphenyl)-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid |
|---|---|
| PubChem CID | 174301693 |
| Molecular Formula | C51H52N4O6 |
| Molecular Weight | 817.00 g/mol |
| Exact Mass | 816.39 |
| IUPAC Name | tert-butyl N-[[4-[(8,9,10,11-tetrahydrochrysene-2-carbonylamino)methyl]phenyl]methyl]carbamate;2-[4-(2-ethenylphenyl)-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-2-yl]acetic acid |
| SMILES | C=Cc1ccccc1N1Cc2ccccc2NC(CC(=O)O)C1=O.CC(C)(C)OC(=O)NCc1ccc(CNC(=O)c2ccc3c(c2)=CCc2c4c(ccc2=3)=CCCC4)cc1 |
| InChI | InChI=1S/C32H34N2O3.C19H18N2O3/c1-32(2,3)37-31(36)34-20-22-10-8-21(9-11-22)19-33-30(35)25-14-15-27-24(18-25)13-17-28-26-7-5-4-6-23(26)12-16-29(27)28;1-2-13-7-4-6-10-17(13)21-12-14-8-3-5-9-15(14)20-16(19(21)24)11-18(22)23/h6,8-16,18H,4-5,7,17,19-20H2,1-3H3,(H,33,35)(H,34,36);2-10,16,20H,1,11-12H2,(H,22,23) |
| InChIKey | MAAILHXGWSHFKY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.00 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |