About (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine
(2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine (PubChem CID 174302101) has the molecular formula C13H13AsClN5O5
and a molecular weight of 429.65 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine.
Molecular Properties
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine |
| PubChem CID | 174302101 |
| Molecular Formula | C13H13AsClN5O5 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.Clc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C8H10AsNO5.C5H3ClN4/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;6-4-3-5(9-1-7-3)10-2-8-4/h2-5,14H,1H3,(H,10,11)(H,12,13);1-2H,(H,7,8,9,10) |
| InChIKey | HIJHGUVDVIBSDO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine?
The IUPAC name of (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine (CID 174302101) is (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine.
What is the SMILES notation for (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine?
The canonical SMILES for (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine is CC(=O)Nc1ccccc1[As](=O)(O)OO.Clc1ncnc2nc[nH]c12.
What is the InChIKey of (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine?
The InChIKey is HIJHGUVDVIBSDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10AsNO5.C5H3ClN4/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;6-4-3-5(9-1-7-3)10-2-8-4/h2-5,14H,1H3,(H,10,11)(H,12,13);1-2H,(H,7,8,9,10).
What are the key properties of (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine?
(2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine has a molecular weight of 429.65 g/mol, XLogP of 0.71, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidophenyl)-hydroperoxyarsinic acid;6-chloro-7H-purine is sourced from PubChem (CID 174302101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).