C26H37N5O3 — CID 174302230
11,24,27-trioxa-1,4,18,21,32-pentazapentacyclo[19.8.5.05,10.09,13.012,17]tetratriaconta-5,7,9,12,14,16-hexaene (PubChem CID 174302230) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 11,24,27-trioxa-1,4,18,21,32-pentazapentacyclo[19.8.5.05,10.09,13.012,17]tetratriaconta-5,7,9,12,14,16-hexaene.
| Compound Name | 11,24,27-trioxa-1,4,18,21,32-pentazapentacyclo[19.8.5.05,10.09,13.012,17]tetratriaconta-5,7,9,12,14,16-hexaene |
|---|---|
| PubChem CID | 174302230 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 11,24,27-trioxa-1,4,18,21,32-pentazapentacyclo[19.8.5.05,10.09,13.012,17]tetratriaconta-5,7,9,12,14,16-hexaene |
| SMILES | c1cc2c3oc4c(cccc4c3c1)NCCN1CCNCCN(CCN2)CCOCCOCC1 |
| InChI | InChI=1S/C26H37N5O3/c1-3-21-22-4-2-6-24-26(22)34-25(21)23(5-1)28-9-13-30-11-7-27-8-12-31(14-10-29-24)16-18-33-20-19-32-17-15-30/h1-6,27-29H,7-20H2 |
| InChIKey | GPWGUUZZINTTJW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|