C22H26F2N2O5 — CID 174302636
cyclohexylmethyl 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate (PubChem CID 174302636) has the molecular formula C22H26F2N2O5 and a molecular weight of 436.46 g/mol. Its IUPAC name is cyclohexylmethyl 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate.
| Compound Name | cyclohexylmethyl 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 174302636 |
| Molecular Formula | C22H26F2N2O5 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | cyclohexylmethyl 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
| SMILES | COc1c(C2C(C(=O)OCC3CCCCC3)=C(C)NC(C)=C2[N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C22H26F2N2O5/c1-12-17(22(27)31-11-14-7-5-4-6-8-14)18(20(26(28)29)13(2)25-12)15-9-10-16(23)19(24)21(15)30-3/h9-10,14,18,25H,4-8,11H2,1-3H3 |
| InChIKey | WZKLNHJPSFIWAC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|