C23H28N2O3 — CID 174302698
3-[(4-butan-2-yloxy-3,5-dimethylphenyl)methyl]-1-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 174302698) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[(4-butan-2-yloxy-3,5-dimethylphenyl)methyl]-1-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(4-butan-2-yloxy-3,5-dimethylphenyl)methyl]-1-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174302698 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[(4-butan-2-yloxy-3,5-dimethylphenyl)methyl]-1-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | CCC(C)Oc1c(C)cc(CN2C(=O)CN(c3ccc(C)cc3)C2=O)cc1C |
| InChI | InChI=1S/C23H28N2O3/c1-6-18(5)28-22-16(3)11-19(12-17(22)4)13-25-21(26)14-24(23(25)27)20-9-7-15(2)8-10-20/h7-12,18H,6,13-14H2,1-5H3 |
| InChIKey | WKXNNBHLBLDOGT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|