C23H22F2N2O5 — CID 174303044
4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1-(2-phenylethyl)-4H-pyridine-3-carboxylic acid (PubChem CID 174303044) has the molecular formula C23H22F2N2O5 and a molecular weight of 444.43 g/mol. Its IUPAC name is 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1-(2-phenylethyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1-(2-phenylethyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174303044 |
| Molecular Formula | C23H22F2N2O5 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-(3,4-difluoro-2-methoxyphenyl)-2,6-dimethyl-5-nitro-1-(2-phenylethyl)-4H-pyridine-3-carboxylic acid |
| SMILES | COc1c(C2C(C(=O)O)=C(C)N(CCc3ccccc3)C(C)=C2[N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C23H22F2N2O5/c1-13-18(23(28)29)19(16-9-10-17(24)20(25)22(16)32-3)21(27(30)31)14(2)26(13)12-11-15-7-5-4-6-8-15/h4-10,19H,11-12H2,1-3H3,(H,28,29) |
| InChIKey | VTZFRZFUFJNJRD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|