C13H14N2O4S — CID 174303296
bicyclo[4.2.0]octa-1(6),2,4-trien-3-ol;2-methylpyrimidine-4-sulfonic acid (PubChem CID 174303296) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1(6),2,4-trien-3-ol;2-methylpyrimidine-4-sulfonic acid.
| Compound Name | bicyclo[4.2.0]octa-1(6),2,4-trien-3-ol;2-methylpyrimidine-4-sulfonic acid |
|---|---|
| PubChem CID | 174303296 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | bicyclo[4.2.0]octa-1(6),2,4-trien-3-ol;2-methylpyrimidine-4-sulfonic acid |
| SMILES | Cc1nccc(S(=O)(=O)O)n1.Oc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C8H8O.C5H6N2O3S/c9-8-4-3-6-1-2-7(6)5-8;1-4-6-3-2-5(7-4)11(8,9)10/h3-5,9H,1-2H2;2-3H,1H3,(H,8,9,10) |
| InChIKey | YGTFRZMKILGKJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|