C22H16F2N2O2+2 — CID 174303318
methyl 1-(7,9-difluoro-3-methylidene-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-4-yl)pyridin-1-ium-2-carboxylate (PubChem CID 174303318) has the molecular formula C22H16F2N2O2+2 and a molecular weight of 378.38 g/mol. Its IUPAC name is methyl 1-(7,9-difluoro-3-methylidene-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-4-yl)pyridin-1-ium-2-carboxylate.
| Compound Name | methyl 1-(7,9-difluoro-3-methylidene-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-4-yl)pyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 174303318 |
| Molecular Formula | C22H16F2N2O2+2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | methyl 1-(7,9-difluoro-3-methylidene-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-4-yl)pyridin-1-ium-2-carboxylate |
| SMILES | C=C1C2[n+]3ccccc3-c3c(F)cc(F)cc3C12[n+]1ccccc1C(=O)OC |
| InChI | InChI=1S/C22H16F2N2O2/c1-13-20-22(13,26-10-6-4-8-18(26)21(27)28-2)15-11-14(23)12-16(24)19(15)17-7-3-5-9-25(17)20/h3-12,20H,1H2,2H3/q+2 |
| InChIKey | VWXLDYVHGGSODA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|