About N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine
N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine (PubChem CID 174303347) has the molecular formula C11H13N7OS
and a molecular weight of 291.34 g/mol. Its IUPAC name is N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine |
| PubChem CID | 174303347 |
| Molecular Formula | C11H13N7OS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine |
| SMILES | N#CN/C=N/Cc1ccco1.NC(N)=Nc1nccs1 |
| InChI | InChI=1S/C7H7N3O.C4H6N4S/c8-5-10-6-9-4-7-2-1-3-11-7;5-3(6)8-4-7-1-2-9-4/h1-3,6H,4H2,(H,9,10);1-2H,(H4,5,6,7,8) |
| InChIKey | ZVDIORWXJCOHRE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine?
The IUPAC name of N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine (CID 174303347) is N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine?
The canonical SMILES for N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine is N#CN/C=N/Cc1ccco1.NC(N)=Nc1nccs1.
What is the InChIKey of N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine?
The InChIKey is ZVDIORWXJCOHRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.C4H6N4S/c8-5-10-6-9-4-7-2-1-3-11-7;5-3(6)8-4-7-1-2-9-4/h1-3,6H,4H2,(H,9,10);1-2H,(H4,5,6,7,8).
What are the key properties of N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine?
N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine has a molecular weight of 291.34 g/mol, XLogP of 0.93, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-(furan-2-ylmethyl)methanimidamide;2-(1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 174303347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).