C61H41N3O — CID 174304257
2-(1-cyclohexa-1,5-dien-1-ylnaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-[4-(3,4,5-triphenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 174304257) has the molecular formula C61H41N3O and a molecular weight of 832.02 g/mol. Its IUPAC name is 2-(1-cyclohexa-1,5-dien-1-ylnaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-[4-(3,4,5-triphenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1-cyclohexa-1,5-dien-1-ylnaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-[4-(3,4,5-triphenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174304257 |
| Molecular Formula | C61H41N3O |
| Molecular Weight | 832.02 g/mol |
| Exact Mass | 831.32 |
| IUPAC Name | 2-(1-cyclohexa-1,5-dien-1-ylnaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-[4-(3,4,5-triphenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | C1=CC(c2cccc3ccc4c(oc5cccc(-c6nc(-c7ccccc7)nc(-c7ccc(-c8cc(-c9ccccc9)c(-c9ccccc9)c(-c9ccccc9)c8)cc7)n6)c54)c23)=CCC1 |
| InChI | InChI=1S/C61H41N3O/c1-6-18-41(19-7-1)49-29-16-28-45-36-37-50-57-51(30-17-31-54(57)65-58(50)56(45)49)61-63-59(46-26-14-5-15-27-46)62-60(64-61)47-34-32-40(33-35-47)48-38-52(42-20-8-2-9-21-42)55(44-24-12-4-13-25-44)53(39-48)43-22-10-3-11-23-43/h2-6,8-39H,1,7H2 |
| InChIKey | QSQUVUUKXDGTRB-UHFFFAOYSA-N |
| XLogP | 16.33 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.02 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |