C16H25F3O6 — CID 174304807
[(2R,3R,4S,5R,6S)-5-acetyloxy-2-ethyl-3-methyl-6-(4,4,4-trifluorobutoxy)oxan-4-yl] acetate (PubChem CID 174304807) has the molecular formula C16H25F3O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-acetyloxy-2-ethyl-3-methyl-6-(4,4,4-trifluorobutoxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-acetyloxy-2-ethyl-3-methyl-6-(4,4,4-trifluorobutoxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 174304807 |
| Molecular Formula | C16H25F3O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-acetyloxy-2-ethyl-3-methyl-6-(4,4,4-trifluorobutoxy)oxan-4-yl] acetate |
| SMILES | CC[C@H]1O[C@H](OCCCC(F)(F)F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C16H25F3O6/c1-5-12-9(2)13(23-10(3)20)14(24-11(4)21)15(25-12)22-8-6-7-16(17,18)19/h9,12-15H,5-8H2,1-4H3/t9-,12-,13+,14-,15+/m1/s1 |
| InChIKey | JQWVRRBWHTYCNT-CEVLRCNZSA-N |
| XLogP | 2.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|