C15H27NO — CID 174305707
N-[(3Z,5Z)-2,4-dimethylnona-3,5-dien-3-yl]oxolan-3-amine (PubChem CID 174305707) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N-[(3Z,5Z)-2,4-dimethylnona-3,5-dien-3-yl]oxolan-3-amine.
| Compound Name | N-[(3Z,5Z)-2,4-dimethylnona-3,5-dien-3-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 174305707 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-[(3Z,5Z)-2,4-dimethylnona-3,5-dien-3-yl]oxolan-3-amine |
| SMILES | CCC/C=C\C(C)=C(/NC1CCOC1)C(C)C |
| InChI | InChI=1S/C15H27NO/c1-5-6-7-8-13(4)15(12(2)3)16-14-9-10-17-11-14/h7-8,12,14,16H,5-6,9-11H2,1-4H3/b8-7-,15-13- |
| InChIKey | PROWYEHYEAWMLM-PHJBAXJRSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|